Chemical Identity
Molecular FormulaC20H25N7O6
Molar Mass (g/mol)459.450
SMILESCC1=C(C(=O)NCCCN)N=CN=C1N
InChIInChI=1S/C20H25N7O6/c1-12-17(24-10-23-18(12)25-20(27)28-2)19(26)22-9-8-15(26)14(16(22)21)13(27)7-5-6-11(27)3/h10-11,14-15,21H,5-9H2,1-3H3,(H,24,25)(H2,21,22,26) (H,27,28)
PubChem CID135398735
Summary
Vitamin B9, known as folate, is a water-soluble vitamin required for DNA synthesis, cell division, amino acid metabolism, and methylation reactions. Folate is particularly important in rapidly growing tissues because it helps support the formation of new cells and the maintenance of genetic material. Naturally occurring folate is found in many plant foods, while folic acid is the synthetic form used in supplements and fortified products.
One of folate’s most critical functions involves DNA synthesis and repair. Every time a cell divides, new genetic material must be accurately produced. Folate-dependent enzymes participate in the formation of nucleotides, the building blocks of DNA and RNA. Without adequate folate, normal cellular replication and maintenance become impaired.
Vitamin B9 also plays a major role in methylation pathways. Methylation is a biochemical process involved in gene regulation, neurotransmitter production, detoxification, and cellular communication. Folate works closely with Vitamins B6 and B12 to support these pathways and maintain normal homocysteine metabolism.
The vitamin is especially important for tissues characterized by rapid growth and turnover, including bone marrow, digestive tract tissues, and developing cells. Through its involvement in nucleotide production and amino acid metabolism, folate contributes to healthy red blood cell formation and overall cellular function.
Excellent plant-based sources of folate include lentils, chickpeas, black beans, spinach, kale, asparagus, broccoli, Brussels sprouts, avocados, oranges, and many leafy green vegetables. Whole-food plant-based dietary patterns are typically rich in natural folate and provide numerous supporting nutrients.
Insufficient folate intake may impair DNA synthesis, reduce healthy red blood cell production, and disrupt methylation processes. Since folate participates in fundamental cellular activities, deficiency can affect many body systems.
Vitamin B9 serves as a cornerstone nutrient for cellular growth, genetic stability, and metabolic regulation. Its role in DNA production, methylation, amino acid metabolism, and cell division makes it one of the most important vitamins for maintaining healthy cellular function and supporting long-term physiological health.